ChemNet > CAS > 261762-81-6 6-Chloro-2-fluoro-3-methylbenzoyl chloride
261762-81-6 6-Chloro-2-fluoro-3-methylbenzoyl chloride
Nazwa produktu: |
6-Chloro-2-fluoro-3-methylbenzoyl chloride |
Synonimy |
6-Chloro-2-fluoro-m-toluoyl chloride |
MF |
C8H5Cl2FO |
Masie cząsteczkowej |
207.0291 |
InChI |
InChI=1/C8H5Cl2FO/c1-4-2-3-5(9)6(7(4)11)8(10)12/h2-3H,1H3 |
Nr CAS |
261762-81-6 |
Struktury molekularnej |
|
Gęstość |
1.396g/cm3 |
Temperatura wrzenia |
247.1°C at 760 mmHg |
Współczynnik załamania |
1.535 |
Temperatura zapłonu |
103.2°C |
Symbole zagrożenia |
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|